C35H37N3O4 — CID 11801049
diethyl 8-methyl-3,13-bis(1-phenylpropyl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-5,11-dicarboxylate (PubChem CID 11801049) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is diethyl 8-methyl-3,13-bis(1-phenylpropyl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-5,11-dicarboxylate.
| Compound Name | diethyl 8-methyl-3,13-bis(1-phenylpropyl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 11801049 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | diethyl 8-methyl-3,13-bis(1-phenylpropyl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-5,11-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(c(C(CC)c3ccccc3)n1)c1c(C(CC)c3ccccc3)nc(C(=O)OCC)cc1n2C |
| InChI | InChI=1S/C35H37N3O4/c1-6-24(22-16-12-10-13-17-22)32-30-28(20-26(36-32)34(39)41-8-3)38(5)29-21-27(35(40)42-9-4)37-33(31(29)30)25(7-2)23-18-14-11-15-19-23/h10-21,24-25H,6-9H2,1-5H3 |
| InChIKey | MYQDJAUESGDDOO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |