C14H27BO3 — CID 162415765
4,4,5,5-tetramethyl-2-[(3R,4S)-4-(2-methylpropyl)oxolan-3-yl]-1,3,2-dioxaborolane (PubChem CID 162415765) has the molecular formula C14H27BO3 and a molecular weight of 254.18 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(3R,4S)-4-(2-methylpropyl)oxolan-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(3R,4S)-4-(2-methylpropyl)oxolan-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162415765 |
| Molecular Formula | C14H27BO3 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(3R,4S)-4-(2-methylpropyl)oxolan-3-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)C[C@@H]1COC[C@@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H27BO3/c1-10(2)7-11-8-16-9-12(11)15-17-13(3,4)14(5,6)18-15/h10-12H,7-9H2,1-6H3/t11-,12+/m1/s1 |
| InChIKey | HTGLORJQJRWAQT-NEPJUHHUSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|