C10H17FO3Si — CID 162415963
(3aR,4S,5R,6aS)-5-[fluoro(dimethyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 162415963) has the molecular formula C10H17FO3Si and a molecular weight of 232.33 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-[fluoro(dimethyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-[fluoro(dimethyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 162415963 |
| Molecular Formula | C10H17FO3Si |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-[fluoro(dimethyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C[Si](C)(F)[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C10H17FO3Si/c1-15(2,11)9-4-8-6(7(9)5-12)3-10(13)14-8/h6-9,12H,3-5H2,1-2H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | RRKJSFCHUNQADI-LURQLKTLSA-N |
| XLogP | 1.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|