C33H30NO5P — CID 162416291
methyl (2S)-1-[2-(2-diphenylphosphorylphenyl)-3-oxo-3-phenylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 162416291) has the molecular formula C33H30NO5P and a molecular weight of 551.58 g/mol. Its IUPAC name is methyl (2S)-1-[2-(2-diphenylphosphorylphenyl)-3-oxo-3-phenylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-(2-diphenylphosphorylphenyl)-3-oxo-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162416291 |
| Molecular Formula | C33H30NO5P |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | methyl (2S)-1-[2-(2-diphenylphosphorylphenyl)-3-oxo-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)C(C(=O)c1ccccc1)c1ccccc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30NO5P/c1-39-33(37)28-21-13-23-34(28)32(36)30(31(35)24-14-5-2-6-15-24)27-20-11-12-22-29(27)40(38,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-12,14-20,22,28,30H,13,21,23H2,1H3/t28-,30?/m0/s1 |
| InChIKey | FCZZKRPEQUYFEH-MBCWZBCWSA-N |
| XLogP | 4.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|