About cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone
cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone (PubChem CID 162416752) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone |
| PubChem CID | 162416752 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone |
| SMILES | O=C(C1CCCCC1)[C@@H]1COCCO1 |
| InChI | InChI=1S/C11H18O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h9-10H,1-8H2/t10-/m0/s1 |
| InChIKey | WAAXIYWBCKAYJJ-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone?
The IUPAC name of cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone (CID 162416752) is cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone.
What is the SMILES notation for cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone?
The canonical SMILES for cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone is O=C(C1CCCCC1)[C@@H]1COCCO1.
What is the InChIKey of cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone?
The InChIKey is WAAXIYWBCKAYJJ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H18O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h9-10H,1-8H2/t10-/m0/s1.
What are the key properties of cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone?
cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone has a molecular weight of 198.26 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[(2S)-1,4-dioxan-2-yl]methanone is sourced from PubChem (CID 162416752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).