C11H18O3 — CID 65350629
cyclohexyl(1,4-dioxan-2-yl)methanone (PubChem CID 65350629) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is cyclohexyl(1,4-dioxan-2-yl)methanone.
| Compound Name | cyclohexyl(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 65350629 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | cyclohexyl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1CCCCC1)C1COCCO1 |
| InChI | InChI=1S/C11H18O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h9-10H,1-8H2 |
| InChIKey | WAAXIYWBCKAYJJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |