C32H22F6N+ — CID 162416981
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,4,6-triphenylpyridin-1-ium (PubChem CID 162416981) has the molecular formula C32H22F6N+ and a molecular weight of 534.52 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,4,6-triphenylpyridin-1-ium.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 162416981 |
| Molecular Formula | C32H22F6N+ |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,4,6-triphenylpyridin-1-ium |
| SMILES | FC(F)(F)c1cc(C[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H22F6N/c33-31(34,35)27-16-22(17-28(20-27)32(36,37)38)21-39-29(24-12-6-2-7-13-24)18-26(23-10-4-1-5-11-23)19-30(39)25-14-8-3-9-15-25/h1-20H,21H2/q+1 |
| InChIKey | BWLBPSVJANZDMB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|