C15H23NO — CID 162417269
(1S)-5-(3-aminoprop-1-en-2-yl)-1-(cyclopenten-1-yl)-2-methylcyclohex-2-en-1-ol (PubChem CID 162417269) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (1S)-5-(3-aminoprop-1-en-2-yl)-1-(cyclopenten-1-yl)-2-methylcyclohex-2-en-1-ol.
| Compound Name | (1S)-5-(3-aminoprop-1-en-2-yl)-1-(cyclopenten-1-yl)-2-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162417269 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (1S)-5-(3-aminoprop-1-en-2-yl)-1-(cyclopenten-1-yl)-2-methylcyclohex-2-en-1-ol |
| SMILES | C=C(CN)C1CC=C(C)[C@](O)(C2=CCCC2)C1 |
| InChI | InChI=1S/C15H23NO/c1-11(10-16)13-8-7-12(2)15(17,9-13)14-5-3-4-6-14/h5,7,13,17H,1,3-4,6,8-10,16H2,2H3/t13?,15-/m0/s1 |
| InChIKey | WDQRNXHQNTWHPK-WUJWULDRSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|