C7H8O5 — CID 162417594
[(3aS,4R,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl] formate (PubChem CID 162417594) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl] formate.
| Compound Name | [(3aS,4R,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl] formate |
|---|---|
| PubChem CID | 162417594 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | [(3aS,4R,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl] formate |
| SMILES | O=CO[C@H]1OC[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C7H8O5/c8-3-11-7-4-1-6(9)12-5(4)2-10-7/h3-5,7H,1-2H2/t4-,5-,7+/m0/s1 |
| InChIKey | BMOGZZYRFDKIFB-KZLJYQGOSA-N |
| XLogP | -0.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|