C27H33NO7 — CID 162417636
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-deuterio-4-oxo-4-(4-phenylphenyl)butanoate (PubChem CID 162417636) has the molecular formula C27H33NO7 and a molecular weight of 484.57 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-deuterio-4-oxo-4-(4-phenylphenyl)butanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-deuterio-4-oxo-4-(4-phenylphenyl)butanoate |
|---|---|
| PubChem CID | 162417636 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-deuterio-4-oxo-4-(4-phenylphenyl)butanoate |
| SMILES | [2H]C(CC(=O)c1ccc(-c2ccccc2)cc1)(C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33NO7/c1-26(2,3)34-24(31)28(25(32)35-27(4,5)6)21(23(30)33-7)17-22(29)20-15-13-19(14-16-20)18-11-9-8-10-12-18/h8-16,21H,17H2,1-7H3/i21D |
| InChIKey | HRKKQBYQKXYWPF-KRLANHAZSA-N |
| XLogP | 5.64 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|