C22H28F3NO7 — CID 162417628
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate (PubChem CID 162417628) has the molecular formula C22H28F3NO7 and a molecular weight of 475.46 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 162417628 |
| Molecular Formula | C22H28F3NO7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)C(CC(=O)c1cccc(C(F)(F)F)c1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28F3NO7/c1-20(2,3)32-18(29)26(19(30)33-21(4,5)6)15(17(28)31-7)12-16(27)13-9-8-10-14(11-13)22(23,24)25/h8-11,15H,12H2,1-7H3 |
| InChIKey | CDKASCDSTWYCDW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|