C16H18F3NO5 — CID 135086708
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate (PubChem CID 135086708) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 135086708 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO5/c1-15(2,3)25-14(23)20-11(13(22)24-4)12(21)9-6-5-7-10(8-9)16(17,18)19/h5-8,11H,1-4H3,(H,20,23) |
| InChIKey | AQJQYNIIICSMIE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|