C20H27F4NO3 — CID 91737213
nonyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 91737213) has the molecular formula C20H27F4NO3 and a molecular weight of 405.43 g/mol. Its IUPAC name is nonyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | nonyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 91737213 |
| Molecular Formula | C20H27F4NO3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | nonyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | CCCCCCCCCOC(=O)C(C)NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C20H27F4NO3/c1-3-4-5-6-7-8-9-12-28-19(27)14(2)25-18(26)16-13-15(20(22,23)24)10-11-17(16)21/h10-11,13-14H,3-9,12H2,1-2H3,(H,25,26) |
| InChIKey | OCBLGLDAZPGFQO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|