C19H25F4NO3 — CID 91737212
octyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 91737212) has the molecular formula C19H25F4NO3 and a molecular weight of 391.41 g/mol. Its IUPAC name is octyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | octyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 91737212 |
| Molecular Formula | C19H25F4NO3 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | octyl 2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | CCCCCCCCOC(=O)C(C)NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C19H25F4NO3/c1-3-4-5-6-7-8-11-27-18(26)13(2)24-17(25)15-12-14(19(21,22)23)9-10-16(15)20/h9-10,12-13H,3-8,11H2,1-2H3,(H,24,25) |
| InChIKey | BRRJLEPSTFDNBM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|