C17H22FNO5 — CID 67370692
methyl (2S)-5-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate (PubChem CID 67370692) has the molecular formula C17H22FNO5 and a molecular weight of 339.36 g/mol. Its IUPAC name is methyl (2S)-5-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate.
| Compound Name | methyl (2S)-5-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
|---|---|
| PubChem CID | 67370692 |
| Molecular Formula | C17H22FNO5 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl (2S)-5-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
| SMILES | COC(=O)[C@H](CC(=O)Cc1ccc(F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22FNO5/c1-17(2,3)24-16(22)19-14(15(21)23-4)10-13(20)9-11-5-7-12(18)8-6-11/h5-8,14H,9-10H2,1-4H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | YRUQRKBTXYYVLP-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |