C11H12F3NO — CID 162417830
(2R,3R)-3-[6-(trifluoromethyl)-3-pyridinyl]pent-4-en-2-ol (PubChem CID 162417830) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is (2R,3R)-3-[6-(trifluoromethyl)-3-pyridinyl]pent-4-en-2-ol.
| Compound Name | (2R,3R)-3-[6-(trifluoromethyl)-3-pyridinyl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 162417830 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (2R,3R)-3-[6-(trifluoromethyl)-3-pyridinyl]pent-4-en-2-ol |
| SMILES | C=C[C@H](c1ccc(C(F)(F)F)nc1)[C@@H](C)O |
| InChI | InChI=1S/C11H12F3NO/c1-3-9(7(2)16)8-4-5-10(15-6-8)11(12,13)14/h3-7,9,16H,1H2,2H3/t7-,9+/m1/s1 |
| InChIKey | CKYUJVCKXKUIHX-APPZFPTMSA-N |
| XLogP | 2.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|