C19H22O3S — CID 162418916
(E)-6-(benzenesulfonyl)-4-methyl-1-phenylhex-4-en-3-ol (PubChem CID 162418916) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is (E)-6-(benzenesulfonyl)-4-methyl-1-phenylhex-4-en-3-ol.
| Compound Name | (E)-6-(benzenesulfonyl)-4-methyl-1-phenylhex-4-en-3-ol |
|---|---|
| PubChem CID | 162418916 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (E)-6-(benzenesulfonyl)-4-methyl-1-phenylhex-4-en-3-ol |
| SMILES | C/C(=C\CS(=O)(=O)c1ccccc1)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O3S/c1-16(19(20)13-12-17-8-4-2-5-9-17)14-15-23(21,22)18-10-6-3-7-11-18/h2-11,14,19-20H,12-13,15H2,1H3/b16-14+ |
| InChIKey | NFBJFRURFBQMCL-JQIJEIRASA-N |
| XLogP | 3.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|