C34H41BrN2 — CID 162419125
2-(1-adamantyl)-6-[6-(4-bromophenyl)-4-tert-butyl-2-pyridinyl]-4-tert-butylpyridine (PubChem CID 162419125) has the molecular formula C34H41BrN2 and a molecular weight of 557.62 g/mol. Its IUPAC name is 2-(1-adamantyl)-6-[6-(4-bromophenyl)-4-tert-butyl-2-pyridinyl]-4-tert-butylpyridine.
| Compound Name | 2-(1-adamantyl)-6-[6-(4-bromophenyl)-4-tert-butyl-2-pyridinyl]-4-tert-butylpyridine |
|---|---|
| PubChem CID | 162419125 |
| Molecular Formula | C34H41BrN2 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-(1-adamantyl)-6-[6-(4-bromophenyl)-4-tert-butyl-2-pyridinyl]-4-tert-butylpyridine |
| SMILES | CC(C)(C)c1cc(-c2ccc(Br)cc2)nc(-c2cc(C(C)(C)C)cc(C34CC5CC(CC(C5)C3)C4)n2)c1 |
| InChI | InChI=1S/C34H41BrN2/c1-32(2,3)25-14-28(24-7-9-27(35)10-8-24)36-29(15-25)30-16-26(33(4,5)6)17-31(37-30)34-18-21-11-22(19-34)13-23(12-21)20-34/h7-10,14-17,21-23H,11-13,18-20H2,1-6H3 |
| InChIKey | MIRHJXLPIXXCGJ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |