C15H22O5 — CID 162419140
methyl 10'-ethenylspiro[1,3-dioxolane-2,9'-3-oxabicyclo[4.3.1]decane]-1'-carboxylate (PubChem CID 162419140) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 10'-ethenylspiro[1,3-dioxolane-2,9'-3-oxabicyclo[4.3.1]decane]-1'-carboxylate.
| Compound Name | methyl 10'-ethenylspiro[1,3-dioxolane-2,9'-3-oxabicyclo[4.3.1]decane]-1'-carboxylate |
|---|---|
| PubChem CID | 162419140 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | methyl 10'-ethenylspiro[1,3-dioxolane-2,9'-3-oxabicyclo[4.3.1]decane]-1'-carboxylate |
| SMILES | C=CC1C2CCOCC1(C(=O)OC)C1(CC2)OCCO1 |
| InChI | InChI=1S/C15H22O5/c1-3-12-11-4-6-15(19-8-9-20-15)14(12,13(16)17-2)10-18-7-5-11/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | UIHLFIDHJQEJFV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|