About ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate
ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate (PubChem CID 162419452) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate.
Analyze ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate?
The IUPAC name of ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate (CID 162419452) is ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate is CCOC(=O)C1=NNC2c3ccccc3CC12.
What is the InChIKey of ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate?
The InChIKey is OISBFLXBIJOJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-2-17-13(16)12-10-7-8-5-3-4-6-9(8)11(10)14-15-12/h3-6,10-11,14H,2,7H2,1H3.
What are the key properties of ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate?
ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3a,4,8b-tetrahydroindeno[1,2-c]pyrazole-3-carboxylate is sourced from PubChem (CID 162419452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).