C27H41N3O8Si — CID 162419704
2-tert-butyl-6-[(E)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxyethoxyiminomethyl]-4-(3-trimethoxysilylpropylamino)phenol (PubChem CID 162419704) has the molecular formula C27H41N3O8Si and a molecular weight of 563.72 g/mol. Its IUPAC name is 2-tert-butyl-6-[(E)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxyethoxyiminomethyl]-4-(3-trimethoxysilylpropylamino)phenol.
| Compound Name | 2-tert-butyl-6-[(E)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxyethoxyiminomethyl]-4-(3-trimethoxysilylpropylamino)phenol |
|---|---|
| PubChem CID | 162419704 |
| Molecular Formula | C27H41N3O8Si |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 2-tert-butyl-6-[(E)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxyethoxyiminomethyl]-4-(3-trimethoxysilylpropylamino)phenol |
| SMILES | COc1cccc(/C=N/OCCO/N=C/c2cc(NCCC[Si](OC)(OC)OC)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C27H41N3O8Si/c1-27(2,3)23-17-22(28-12-9-15-39(34-5,35-6)36-7)16-21(25(23)31)19-30-38-14-13-37-29-18-20-10-8-11-24(33-4)26(20)32/h8,10-11,16-19,28,31-32H,9,12-15H2,1-7H3/b29-18+,30-19+ |
| InChIKey | DKXHDICXDLPRNP-ZZASANORSA-N |
| XLogP | 4.49 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|