C9H13NO — CID 162420089
(4aR,8aR)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium (PubChem CID 162420089) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4aR,8aR)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium.
| Compound Name | (4aR,8aR)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium |
|---|---|
| PubChem CID | 162420089 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4aR,8aR)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium |
| SMILES | [O-][N+]1=CC=C[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C9H13NO/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7-9H,1-2,4,6H2/t8-,9-/m1/s1 |
| InChIKey | NOMUGDYUXUKHIB-RKDXNWHRSA-N |
| XLogP | 1.70 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|