C10H11F2N3O3 — CID 162421572
(E)-2-[5-(difluoromethoxy)-3-nitro-2-pyridinyl]-N,N-dimethylethenamine (PubChem CID 162421572) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is (E)-2-[5-(difluoromethoxy)-3-nitro-2-pyridinyl]-N,N-dimethylethenamine.
| Compound Name | (E)-2-[5-(difluoromethoxy)-3-nitro-2-pyridinyl]-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 162421572 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (E)-2-[5-(difluoromethoxy)-3-nitro-2-pyridinyl]-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C/c1ncc(OC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11F2N3O3/c1-14(2)4-3-8-9(15(16)17)5-7(6-13-8)18-10(11)12/h3-6,10H,1-2H3/b4-3+ |
| InChIKey | SFBUQEOMFVYODL-ONEGZZNKSA-N |
| XLogP | 2.12 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|