C11H20Cl2N4O — CID 162422916
5-methoxy-N-(piperidin-4-ylmethyl)pyrimidin-2-amine;dihydrochloride (PubChem CID 162422916) has the molecular formula C11H20Cl2N4O and a molecular weight of 295.21 g/mol. Its IUPAC name is 5-methoxy-N-(piperidin-4-ylmethyl)pyrimidin-2-amine;dihydrochloride.
| Compound Name | 5-methoxy-N-(piperidin-4-ylmethyl)pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 162422916 |
| Molecular Formula | C11H20Cl2N4O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-methoxy-N-(piperidin-4-ylmethyl)pyrimidin-2-amine;dihydrochloride |
| SMILES | COc1cnc(NCC2CCNCC2)nc1.Cl.Cl |
| InChI | InChI=1S/C11H18N4O.2ClH/c1-16-10-7-14-11(15-8-10)13-6-9-2-4-12-5-3-9;;/h7-9,12H,2-6H2,1H3,(H,13,14,15);2*1H |
| InChIKey | UIRXAWYNQIUKDZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |