C13H21N3 — CID 83837408
3,5-dimethyl-N-(piperidin-4-ylmethyl)pyridin-4-amine (PubChem CID 83837408) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3,5-dimethyl-N-(piperidin-4-ylmethyl)pyridin-4-amine.
| Compound Name | 3,5-dimethyl-N-(piperidin-4-ylmethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 83837408 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3,5-dimethyl-N-(piperidin-4-ylmethyl)pyridin-4-amine |
| SMILES | Cc1cncc(C)c1NCC1CCNCC1 |
| InChI | InChI=1S/C13H21N3/c1-10-7-15-8-11(2)13(10)16-9-12-3-5-14-6-4-12/h7-8,12,14H,3-6,9H2,1-2H3,(H,15,16) |
| InChIKey | QYXJBWTVKYQWSC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |