C20H23F2N3O2 — CID 162424053
5-(1,1-difluoro-2-hydroxyethyl)-N-(11,11-dimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-1-methylpyrazole-4-carboxamide (PubChem CID 162424053) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 5-(1,1-difluoro-2-hydroxyethyl)-N-(11,11-dimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-(1,1-difluoro-2-hydroxyethyl)-N-(11,11-dimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162424053 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 5-(1,1-difluoro-2-hydroxyethyl)-N-(11,11-dimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC23CCC(c4ccccc42)C3(C)C)c1C(F)(F)CO |
| InChI | InChI=1S/C20H23F2N3O2/c1-18(2)14-8-9-19(18,15-7-5-4-6-12(14)15)24-17(27)13-10-23-25(3)16(13)20(21,22)11-26/h4-7,10,14,26H,8-9,11H2,1-3H3,(H,24,27) |
| InChIKey | BKVLHKWKVNOXEE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |