C24H26N2O3 — CID 162426350
5-[(3-carbamoylphenyl)methyl]-10-ethyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid (PubChem CID 162426350) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-[(3-carbamoylphenyl)methyl]-10-ethyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid.
| Compound Name | 5-[(3-carbamoylphenyl)methyl]-10-ethyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 162426350 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 5-[(3-carbamoylphenyl)methyl]-10-ethyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
| SMILES | CCC1CCCCc2c1c1cccc(C(=O)O)c1n2Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-2-16-8-3-4-12-20-21(16)18-10-6-11-19(24(28)29)22(18)26(20)14-15-7-5-9-17(13-15)23(25)27/h5-7,9-11,13,16H,2-4,8,12,14H2,1H3,(H2,25,27)(H,28,29) |
| InChIKey | MPMKUACQYJMWTP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|