C60H98O2Si2 — CID 162426747
3-[butyl(dioctyl)silyl]-1-[3-[butyl(dioctyl)silyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-ol (PubChem CID 162426747) has the molecular formula C60H98O2Si2 and a molecular weight of 907.61 g/mol. Its IUPAC name is 3-[butyl(dioctyl)silyl]-1-[3-[butyl(dioctyl)silyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-ol.
| Compound Name | 3-[butyl(dioctyl)silyl]-1-[3-[butyl(dioctyl)silyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 162426747 |
| Molecular Formula | C60H98O2Si2 |
| Molecular Weight | 907.61 g/mol |
| Exact Mass | 906.71 |
| IUPAC Name | 3-[butyl(dioctyl)silyl]-1-[3-[butyl(dioctyl)silyl]-2-hydroxynaphthalen-1-yl]naphthalen-2-ol |
| SMILES | CCCCCCCC[Si](CCCC)(CCCCCCCC)c1cc2ccccc2c(-c2c(O)c([Si](CCCC)(CCCCCCCC)CCCCCCCC)cc3ccccc23)c1O |
| InChI | InChI=1S/C60H98O2Si2/c1-7-13-19-23-27-35-45-63(43-17-11-5,46-36-28-24-20-14-8-2)55-49-51-39-31-33-41-53(51)57(59(55)61)58-54-42-34-32-40-52(54)50-56(60(58)62)64(44-18-12-6,47-37-29-25-21-15-9-3)48-38-30-26-22-16-10-4/h31-34,39-42,49-50,61-62H,7-30,35-38,43-48H2,1-6H3 |
| InChIKey | HUQUXBMSDHMKQP-UHFFFAOYSA-N |
| XLogP | 19.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.61 |
| LogP ≤ 5 | 19.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|