C21H18FN5O — CID 162431522
4-N-[2-fluoro-5-methyl-4-[(6-methyl-3-pyridinyl)oxy]phenyl]quinazoline-4,6-diamine (PubChem CID 162431522) has the molecular formula C21H18FN5O and a molecular weight of 375.41 g/mol. Its IUPAC name is 4-N-[2-fluoro-5-methyl-4-[(6-methyl-3-pyridinyl)oxy]phenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[2-fluoro-5-methyl-4-[(6-methyl-3-pyridinyl)oxy]phenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 162431522 |
| Molecular Formula | C21H18FN5O |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-N-[2-fluoro-5-methyl-4-[(6-methyl-3-pyridinyl)oxy]phenyl]quinazoline-4,6-diamine |
| SMILES | Cc1ccc(Oc2cc(F)c(Nc3ncnc4ccc(N)cc34)cc2C)cn1 |
| InChI | InChI=1S/C21H18FN5O/c1-12-7-19(17(22)9-20(12)28-15-5-3-13(2)24-10-15)27-21-16-8-14(23)4-6-18(16)25-11-26-21/h3-11H,23H2,1-2H3,(H,25,26,27) |
| InChIKey | WVNJDYMZESBPMM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|