C17H19FN2O3 — CID 162432199
methyl 2-[4-(3-fluorophenyl)-5-methyl-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate (PubChem CID 162432199) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 2-[4-(3-fluorophenyl)-5-methyl-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-fluorophenyl)-5-methyl-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 162432199 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 2-[4-(3-fluorophenyl)-5-methyl-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1nc(C(C)C)c(-c2cccc(F)c2)c(C)c1=O |
| InChI | InChI=1S/C17H19FN2O3/c1-10(2)16-15(12-6-5-7-13(18)8-12)11(3)17(22)20(19-16)9-14(21)23-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | MMEVOVRGRHXIKM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |