C28H28FN5O3S — CID 162432451
11-[3-fluoro-4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-5-methyl-3-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 162432451) has the molecular formula C28H28FN5O3S and a molecular weight of 533.63 g/mol. Its IUPAC name is 11-[3-fluoro-4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-5-methyl-3-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 11-[3-fluoro-4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-5-methyl-3-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 162432451 |
| Molecular Formula | C28H28FN5O3S |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 11-[3-fluoro-4-[(4-methylsulfonylpiperidin-1-yl)methyl]phenyl]-5-methyl-3-phenyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | Cn1c(=O)n(-c2ccccc2)c2c3cc(-c4ccc(CN5CCC(S(C)(=O)=O)CC5)c(F)c4)[nH]c3ncc21 |
| InChI | InChI=1S/C28H28FN5O3S/c1-32-25-16-30-27-22(26(25)34(28(32)35)20-6-4-3-5-7-20)15-24(31-27)18-8-9-19(23(29)14-18)17-33-12-10-21(11-13-33)38(2,36)37/h3-9,14-16,21H,10-13,17H2,1-2H3,(H,30,31) |
| InChIKey | BLMQZKKUTPOQQH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |