C24H22N4O3S — CID 162432545
10-(benzenesulfonyl)-5-methyl-12-phenyl-3-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 162432545) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-5-methyl-12-phenyl-3-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 10-(benzenesulfonyl)-5-methyl-12-phenyl-3-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 162432545 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 10-(benzenesulfonyl)-5-methyl-12-phenyl-3-propan-2-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | CC(C)n1c(=O)n(C)c2cnc3c(c(-c4ccccc4)cn3S(=O)(=O)c3ccccc3)c21 |
| InChI | InChI=1S/C24H22N4O3S/c1-16(2)28-22-20(26(3)24(28)29)14-25-23-21(22)19(17-10-6-4-7-11-17)15-27(23)32(30,31)18-12-8-5-9-13-18/h4-16H,1-3H3 |
| InChIKey | AWXFIPPZHFOCQX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |