C20H20N6O — CID 162433567
2-methyl-5-(6-piperazin-1-yl-1,5-naphthyridin-2-yl)indazol-6-ol (PubChem CID 162433567) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-methyl-5-(6-piperazin-1-yl-1,5-naphthyridin-2-yl)indazol-6-ol.
| Compound Name | 2-methyl-5-(6-piperazin-1-yl-1,5-naphthyridin-2-yl)indazol-6-ol |
|---|---|
| PubChem CID | 162433567 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-methyl-5-(6-piperazin-1-yl-1,5-naphthyridin-2-yl)indazol-6-ol |
| SMILES | Cn1cc2cc(-c3ccc4nc(N5CCNCC5)ccc4n3)c(O)cc2n1 |
| InChI | InChI=1S/C20H20N6O/c1-25-12-13-10-14(19(27)11-18(13)24-25)15-2-3-17-16(22-15)4-5-20(23-17)26-8-6-21-7-9-26/h2-5,10-12,21,27H,6-9H2,1H3 |
| InChIKey | IGMWEBBDWAYNHL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |