C26H32N6O2 — CID 162433735
2-[6-(methoxymethoxy)-2-methylindazol-5-yl]-6-(3,3,5,5-tetramethylpiperazin-1-yl)-1,5-naphthyridine (PubChem CID 162433735) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[6-(methoxymethoxy)-2-methylindazol-5-yl]-6-(3,3,5,5-tetramethylpiperazin-1-yl)-1,5-naphthyridine.
| Compound Name | 2-[6-(methoxymethoxy)-2-methylindazol-5-yl]-6-(3,3,5,5-tetramethylpiperazin-1-yl)-1,5-naphthyridine |
|---|---|
| PubChem CID | 162433735 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-[6-(methoxymethoxy)-2-methylindazol-5-yl]-6-(3,3,5,5-tetramethylpiperazin-1-yl)-1,5-naphthyridine |
| SMILES | COCOc1cc2nn(C)cc2cc1-c1ccc2nc(N3CC(C)(C)NC(C)(C)C3)ccc2n1 |
| InChI | InChI=1S/C26H32N6O2/c1-25(2)14-32(15-26(3,4)30-25)24-10-9-20-21(28-24)8-7-19(27-20)18-11-17-13-31(5)29-22(17)12-23(18)34-16-33-6/h7-13,30H,14-16H2,1-6H3 |
| InChIKey | QEDNOEUYJWWKTD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|