C22H22F2N2O5 — CID 162434693
methyl (2E)-2-[2-[[(E)-[4-(difluoromethoxy)-2,3-dihydroinden-1-ylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate (PubChem CID 162434693) has the molecular formula C22H22F2N2O5 and a molecular weight of 432.42 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[(E)-[4-(difluoromethoxy)-2,3-dihydroinden-1-ylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[(E)-[4-(difluoromethoxy)-2,3-dihydroinden-1-ylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 162434693 |
| Molecular Formula | C22H22F2N2O5 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | methyl (2E)-2-[2-[[(E)-[4-(difluoromethoxy)-2,3-dihydroinden-1-ylidene]amino]oxymethyl]-3-methylphenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(C)c1CO/N=C1\CCc2c(OC(F)F)cccc21 |
| InChI | InChI=1S/C22H22F2N2O5/c1-13-6-4-8-16(20(26-29-3)21(27)28-2)17(13)12-30-25-18-11-10-15-14(18)7-5-9-19(15)31-22(23)24/h4-9,22H,10-12H2,1-3H3/b25-18+,26-20+ |
| InChIKey | XYPBXJDPJBKYDW-ICRKYIHISA-N |
| XLogP | 3.99 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|