C14H22F3N2O+ — CID 162434887
methanol;[4-(piperidin-4-ylmethyl)-3-(trifluoromethyl)phenyl]azanium (PubChem CID 162434887) has the molecular formula C14H22F3N2O+ and a molecular weight of 291.34 g/mol. Its IUPAC name is methanol;[4-(piperidin-4-ylmethyl)-3-(trifluoromethyl)phenyl]azanium.
| Compound Name | methanol;[4-(piperidin-4-ylmethyl)-3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 162434887 |
| Molecular Formula | C14H22F3N2O+ |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | methanol;[4-(piperidin-4-ylmethyl)-3-(trifluoromethyl)phenyl]azanium |
| SMILES | CO.[NH3+]c1ccc(CC2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2.CH4O/c14-13(15,16)12-8-11(17)2-1-10(12)7-9-3-5-18-6-4-9;1-2/h1-2,8-9,18H,3-7,17H2;2H,1H3/p+1 |
| InChIKey | LVPYYZNXIFHNDJ-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 59.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |