C20H22FNO3S — CID 162435472
1-[5-fluoro-1-(4-methylphenyl)sulfonylindol-2-yl]-2-methylbutan-1-ol (PubChem CID 162435472) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[5-fluoro-1-(4-methylphenyl)sulfonylindol-2-yl]-2-methylbutan-1-ol.
| Compound Name | 1-[5-fluoro-1-(4-methylphenyl)sulfonylindol-2-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 162435472 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[5-fluoro-1-(4-methylphenyl)sulfonylindol-2-yl]-2-methylbutan-1-ol |
| SMILES | CCC(C)C(O)c1cc2cc(F)ccc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22FNO3S/c1-4-14(3)20(23)19-12-15-11-16(21)7-10-18(15)22(19)26(24,25)17-8-5-13(2)6-9-17/h5-12,14,20,23H,4H2,1-3H3 |
| InChIKey | ZPBYVVZMQNCFLM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |