About 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol
2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol (PubChem CID 162435587) has the molecular formula C15H26ClN3S
and a molecular weight of 315.91 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol |
| PubChem CID | 162435587 |
| Molecular Formula | C15H26ClN3S |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol |
| SMILES | NCCN1CCC(CN)CC1.SCc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H19N3.C7H7ClS/c9-3-6-11-4-1-8(7-10)2-5-11;8-7-3-1-2-6(4-7)5-9/h8H,1-7,9-10H2;1-4,9H,5H2 |
| InChIKey | QQCGACVSAWMATP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol?
The IUPAC name of 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol (CID 162435587) is 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol.
What is the SMILES notation for 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol?
The canonical SMILES for 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol is NCCN1CCC(CN)CC1.SCc1cccc(Cl)c1.
What is the InChIKey of 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol?
The InChIKey is QQCGACVSAWMATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3.C7H7ClS/c9-3-6-11-4-1-8(7-10)2-5-11;8-7-3-1-2-6(4-7)5-9/h8H,1-7,9-10H2;1-4,9H,5H2.
What are the key properties of 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol?
2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol has a molecular weight of 315.91 g/mol, XLogP of 2.39, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;(3-chlorophenyl)methanethiol is sourced from PubChem (CID 162435587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).