C15H18ClN2OSSb — CID 162436605
N-[1-(4-chlorophenyl)ethyl]-5-[methyl(methylamino)stibanyl]thiophene-2-carboxamide (PubChem CID 162436605) has the molecular formula C15H18ClN2OSSb and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-5-[methyl(methylamino)stibanyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-5-[methyl(methylamino)stibanyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162436605 |
| Molecular Formula | C15H18ClN2OSSb |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-5-[methyl(methylamino)stibanyl]thiophene-2-carboxamide |
| SMILES | CN[Sb](C)c1ccc(C(=O)NC(C)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H11ClNOS.CH4N.CH3.Sb/c1-9(10-4-6-11(14)7-5-10)15-13(16)12-3-2-8-17-12;1-2;;/h2-7,9H,1H3,(H,15,16);2H,1H3;1H3;/q;-1;;+1 |
| InChIKey | QRPUIQXLGCFOPH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|