C18H18F2N4O2 — CID 162437881
4-(2,6-difluoro-4-methoxyphenyl)-1-(1-ethanimidoyl-2-imino-3-pyridinyl)pyrrolidin-2-one (PubChem CID 162437881) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-methoxyphenyl)-1-(1-ethanimidoyl-2-imino-3-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(2,6-difluoro-4-methoxyphenyl)-1-(1-ethanimidoyl-2-imino-3-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 162437881 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-(2,6-difluoro-4-methoxyphenyl)-1-(1-ethanimidoyl-2-imino-3-pyridinyl)pyrrolidin-2-one |
| SMILES | [H]/N=c1/c(N2CC(c3c(F)cc(OC)cc3F)CC2=O)cccn1/C(C)=N/[H] |
| InChI | InChI=1S/C18H18F2N4O2/c1-10(21)23-5-3-4-15(18(23)22)24-9-11(6-16(24)25)17-13(19)7-12(26-2)8-14(17)20/h3-5,7-8,11,21-22H,6,9H2,1-2H3/b21-10+,22-18- |
| InChIKey | OTGBJULVUMEUDB-AMRBFANRSA-N |
| XLogP | 2.62 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|