C18H20FN2O3P — CID 170366841
3-[(4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-2-oxopyrrolidin-1-yl]-1,4-dimethylpyridin-2-one (PubChem CID 170366841) has the molecular formula C18H20FN2O3P and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-[(4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-2-oxopyrrolidin-1-yl]-1,4-dimethylpyridin-2-one.
| Compound Name | 3-[(4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-2-oxopyrrolidin-1-yl]-1,4-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 170366841 |
| Molecular Formula | C18H20FN2O3P |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-[(4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-2-oxopyrrolidin-1-yl]-1,4-dimethylpyridin-2-one |
| SMILES | COc1cc(F)c([C@H]2CC(=O)N(c3c(C)ccn(C)c3=O)C2)c(P)c1 |
| InChI | InChI=1S/C18H20FN2O3P/c1-10-4-5-20(2)18(23)17(10)21-9-11(6-15(21)22)16-13(19)7-12(24-3)8-14(16)25/h4-5,7-8,11H,6,9,25H2,1-3H3/t11-/m0/s1 |
| InChIKey | NQSDSSSCSAANDV-NSHDSACASA-N |
| XLogP | 1.86 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|