C17H17F2N2O2P — CID 170367085
(4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-1-(3-fluoro-6-methyl-2-pyridinyl)pyrrolidin-2-one (PubChem CID 170367085) has the molecular formula C17H17F2N2O2P and a molecular weight of 350.31 g/mol. Its IUPAC name is (4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-1-(3-fluoro-6-methyl-2-pyridinyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-1-(3-fluoro-6-methyl-2-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 170367085 |
| Molecular Formula | C17H17F2N2O2P |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (4R)-4-(2-fluoro-4-methoxy-6-phosphanylphenyl)-1-(3-fluoro-6-methyl-2-pyridinyl)pyrrolidin-2-one |
| SMILES | COc1cc(F)c([C@H]2CC(=O)N(c3nc(C)ccc3F)C2)c(P)c1 |
| InChI | InChI=1S/C17H17F2N2O2P/c1-9-3-4-12(18)17(20-9)21-8-10(5-15(21)22)16-13(19)6-11(23-2)7-14(16)24/h3-4,6-7,10H,5,8,24H2,1-2H3/t10-/m0/s1 |
| InChIKey | AJNANQIARDWZAZ-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|