C25H27ClN2O2 — CID 162438779
2-chloro-4-[[6-(4-propan-2-ylbenzoyl)-6-azaspiro[3.5]nonan-9-yl]oxy]benzonitrile (PubChem CID 162438779) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-chloro-4-[[6-(4-propan-2-ylbenzoyl)-6-azaspiro[3.5]nonan-9-yl]oxy]benzonitrile.
| Compound Name | 2-chloro-4-[[6-(4-propan-2-ylbenzoyl)-6-azaspiro[3.5]nonan-9-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 162438779 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-chloro-4-[[6-(4-propan-2-ylbenzoyl)-6-azaspiro[3.5]nonan-9-yl]oxy]benzonitrile |
| SMILES | CC(C)c1ccc(C(=O)N2CCC(Oc3ccc(C#N)c(Cl)c3)C3(CCC3)C2)cc1 |
| InChI | InChI=1S/C25H27ClN2O2/c1-17(2)18-4-6-19(7-5-18)24(29)28-13-10-23(25(16-28)11-3-12-25)30-21-9-8-20(15-27)22(26)14-21/h4-9,14,17,23H,3,10-13,16H2,1-2H3 |
| InChIKey | RIHHQIYGQGKSIJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |