C28H41CmN2- — CID 162439273
N-[2-[3-tert-butyl-5-[2-(2-ethyl-4-methylpiperidin-1-yl)ethyl]phenyl]ethyl]aniline;curium (PubChem CID 162439273) has the molecular formula C28H41CmN2- and a molecular weight of 652.65 g/mol. Its IUPAC name is N-[2-[3-tert-butyl-5-[2-(2-ethyl-4-methylpiperidin-1-yl)ethyl]phenyl]ethyl]aniline;curium.
| Compound Name | N-[2-[3-tert-butyl-5-[2-(2-ethyl-4-methylpiperidin-1-yl)ethyl]phenyl]ethyl]aniline;curium |
|---|---|
| PubChem CID | 162439273 |
| Molecular Formula | C28H41CmN2- |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | N-[2-[3-tert-butyl-5-[2-(2-ethyl-4-methylpiperidin-1-yl)ethyl]phenyl]ethyl]aniline;curium |
| SMILES | CCC1CC(C)CCN1CCc1cc(CCNc2[c-]cccc2)cc(C(C)(C)C)c1.[Cm] |
| InChI | InChI=1S/C28H41N2.Cm/c1-6-27-18-22(2)13-16-30(27)17-14-24-19-23(20-25(21-24)28(3,4)5)12-15-29-26-10-8-7-9-11-26;/h7-10,19-22,27,29H,6,12-18H2,1-5H3;/q-1; |
| InChIKey | SXSDDQZABAMFQJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|