C11H12FN3O3 — CID 162439884
1-(3-fluoro-4-nitrophenyl)-3-methyl-1,3-diazinan-2-one (PubChem CID 162439884) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 1-(3-fluoro-4-nitrophenyl)-3-methyl-1,3-diazinan-2-one.
| Compound Name | 1-(3-fluoro-4-nitrophenyl)-3-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 162439884 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(3-fluoro-4-nitrophenyl)-3-methyl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(c2ccc([N+](=O)[O-])c(F)c2)C1=O |
| InChI | InChI=1S/C11H12FN3O3/c1-13-5-2-6-14(11(13)16)8-3-4-10(15(17)18)9(12)7-8/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | DSHIVRRFOUNRHX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|