C12H8FN3O5 — CID 115948970
7-(3-fluoro-4-nitrophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 115948970) has the molecular formula C12H8FN3O5 and a molecular weight of 293.21 g/mol. Its IUPAC name is 7-(3-fluoro-4-nitrophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(3-fluoro-4-nitrophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 115948970 |
| Molecular Formula | C12H8FN3O5 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 7-(3-fluoro-4-nitrophenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | O=C1NC(=O)C2(CC2)C(=O)N1c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C12H8FN3O5/c13-7-5-6(1-2-8(7)16(20)21)15-10(18)12(3-4-12)9(17)14-11(15)19/h1-2,5H,3-4H2,(H,14,17,19) |
| InChIKey | CCNLXEAZIUDLBJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|