C20H19Cl2N5O3 — CID 162440284
1-(2,6-dichlorophenyl)-4-[4-(2-methoxyethylcarbamoyl)anilino]pyrazole-3-carboxamide (PubChem CID 162440284) has the molecular formula C20H19Cl2N5O3 and a molecular weight of 448.31 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4-[4-(2-methoxyethylcarbamoyl)anilino]pyrazole-3-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)-4-[4-(2-methoxyethylcarbamoyl)anilino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162440284 |
| Molecular Formula | C20H19Cl2N5O3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4-[4-(2-methoxyethylcarbamoyl)anilino]pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Nc2cn(-c3c(Cl)cccc3Cl)nc2C(N)=O)cc1 |
| InChI | InChI=1S/C20H19Cl2N5O3/c1-30-10-9-24-20(29)12-5-7-13(8-6-12)25-16-11-27(26-17(16)19(23)28)18-14(21)3-2-4-15(18)22/h2-8,11,25H,9-10H2,1H3,(H2,23,28)(H,24,29) |
| InChIKey | VKJYDAGFPSLCFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|