About benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium
benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium (PubChem CID 162454004) has the molecular formula C16H13N3OY-2
and a molecular weight of 352.21 g/mol. Its IUPAC name is benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium.
Molecular Properties
| Compound Name | benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium |
| PubChem CID | 162454004 |
| Molecular Formula | C16H13N3OY-2 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium |
| SMILES | O=[C-]Nc1cccc(-c2ccn[nH]2)c1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C10H8N3O.C6H5.Y/c14-7-11-9-3-1-2-8(6-9)10-4-5-12-13-10;1-2-4-6-5-3-1;/h1-6H,(H,11,14)(H,12,13);1-5H;/q2*-1; |
| InChIKey | LDNUEJNKFKWWFN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium?
The IUPAC name of benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium (CID 162454004) is benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium.
What is the SMILES notation for benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium?
The canonical SMILES for benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium is O=[C-]Nc1cccc(-c2ccn[nH]2)c1.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium?
The InChIKey is LDNUEJNKFKWWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N3O.C6H5.Y/c14-7-11-9-3-1-2-8(6-9)10-4-5-12-13-10;1-2-4-6-5-3-1;/h1-6H,(H,11,14)(H,12,13);1-5H;/q2*-1;.
What are the key properties of benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium?
benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium has a molecular weight of 352.21 g/mol, XLogP of 3.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;[3-(1H-pyrazol-5-yl)anilino]methanone;yttrium is sourced from PubChem (CID 162454004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).