C24H48O4S — CID 162458929
[(2R)-2-hydroxy-3-(8-octylsulfanyloctoxy)propyl] 2,2-dimethylpropanoate (PubChem CID 162458929) has the molecular formula C24H48O4S and a molecular weight of 432.71 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(8-octylsulfanyloctoxy)propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-hydroxy-3-(8-octylsulfanyloctoxy)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162458929 |
| Molecular Formula | C24H48O4S |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.33 |
| IUPAC Name | [(2R)-2-hydroxy-3-(8-octylsulfanyloctoxy)propyl] 2,2-dimethylpropanoate |
| SMILES | CCCCCCCCSCCCCCCCCOC[C@@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H48O4S/c1-5-6-7-8-12-15-18-29-19-16-13-10-9-11-14-17-27-20-22(25)21-28-23(26)24(2,3)4/h22,25H,5-21H2,1-4H3/t22-/m1/s1 |
| InChIKey | PPXDHIVDQBAJQU-JOCHJYFZSA-N |
| XLogP | 6.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|