C17H18Cl2N2O3 — CID 162459106
7-[(5-methoxy-2-pyridinyl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride;hydrochloride (PubChem CID 162459106) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 7-[(5-methoxy-2-pyridinyl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride;hydrochloride.
| Compound Name | 7-[(5-methoxy-2-pyridinyl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride;hydrochloride |
|---|---|
| PubChem CID | 162459106 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 7-[(5-methoxy-2-pyridinyl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride;hydrochloride |
| SMILES | COc1ccc(COc2ccc3c(c2)CN(C(=O)Cl)CC3)nc1.Cl |
| InChI | InChI=1S/C17H17ClN2O3.ClH/c1-22-16-5-3-14(19-9-16)11-23-15-4-2-12-6-7-20(17(18)21)10-13(12)8-15;/h2-5,8-9H,6-7,10-11H2,1H3;1H |
| InChIKey | GXCGVFBFLIQZKM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|